C15H19BrClN5OS — CID 120823172
(5-bromothiophen-3-yl)-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone;hydrochloride (PubChem CID 120823172) has the molecular formula C15H19BrClN5OS and a molecular weight of 432.78 g/mol. Its IUPAC name is (5-bromothiophen-3-yl)-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone;hydrochloride.
| Compound Name | (5-bromothiophen-3-yl)-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 120823172 |
| Molecular Formula | C15H19BrClN5OS |
| Molecular Weight | 432.78 g/mol |
| Exact Mass | 431.02 |
| IUPAC Name | (5-bromothiophen-3-yl)-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone;hydrochloride |
| SMILES | Cl.O=C(c1csc(Br)c1)N1CCC(c2nnc3n2CCNC3)CC1 |
| InChI | InChI=1S/C15H18BrN5OS.ClH/c16-12-7-11(9-23-12)15(22)20-4-1-10(2-5-20)14-19-18-13-8-17-3-6-21(13)14;/h7,9-10,17H,1-6,8H2;1H |
| InChIKey | IBROIXPSVBQGGM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.78 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |