C20H28ClN5O3 — CID 120823969
(3,5-dimethoxy-4-methylphenyl)-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone;hydrochloride (PubChem CID 120823969) has the molecular formula C20H28ClN5O3 and a molecular weight of 421.93 g/mol. Its IUPAC name is (3,5-dimethoxy-4-methylphenyl)-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone;hydrochloride.
| Compound Name | (3,5-dimethoxy-4-methylphenyl)-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 120823969 |
| Molecular Formula | C20H28ClN5O3 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | (3,5-dimethoxy-4-methylphenyl)-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone;hydrochloride |
| SMILES | COc1cc(C(=O)N2CCC(c3nnc4n3CCNC4)CC2)cc(OC)c1C.Cl |
| InChI | InChI=1S/C20H27N5O3.ClH/c1-13-16(27-2)10-15(11-17(13)28-3)20(26)24-7-4-14(5-8-24)19-23-22-18-12-21-6-9-25(18)19;/h10-11,14,21H,4-9,12H2,1-3H3;1H |
| InChIKey | FKSNRUNUKASPPI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |