C17H22ClF2N5O2S — CID 120823495
[3-(difluoromethoxy)-5-methylthiophen-2-yl]-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone;hydrochloride (PubChem CID 120823495) has the molecular formula C17H22ClF2N5O2S and a molecular weight of 433.91 g/mol. Its IUPAC name is [3-(difluoromethoxy)-5-methylthiophen-2-yl]-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone;hydrochloride.
| Compound Name | [3-(difluoromethoxy)-5-methylthiophen-2-yl]-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 120823495 |
| Molecular Formula | C17H22ClF2N5O2S |
| Molecular Weight | 433.91 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | [3-(difluoromethoxy)-5-methylthiophen-2-yl]-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone;hydrochloride |
| SMILES | Cc1cc(OC(F)F)c(C(=O)N2CCC(c3nnc4n3CCNC4)CC2)s1.Cl |
| InChI | InChI=1S/C17H21F2N5O2S.ClH/c1-10-8-12(26-17(18)19)14(27-10)16(25)23-5-2-11(3-6-23)15-22-21-13-9-20-4-7-24(13)15;/h8,11,17,20H,2-7,9H2,1H3;1H |
| InChIKey | DRGJSZFSWRWDSW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.91 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |