C19H26ClN5OS — CID 120824065
(2-methyl-5-methylsulfanylphenyl)-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone;hydrochloride (PubChem CID 120824065) has the molecular formula C19H26ClN5OS and a molecular weight of 407.97 g/mol. Its IUPAC name is (2-methyl-5-methylsulfanylphenyl)-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone;hydrochloride.
| Compound Name | (2-methyl-5-methylsulfanylphenyl)-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 120824065 |
| Molecular Formula | C19H26ClN5OS |
| Molecular Weight | 407.97 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | (2-methyl-5-methylsulfanylphenyl)-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone;hydrochloride |
| SMILES | CSc1ccc(C)c(C(=O)N2CCC(c3nnc4n3CCNC4)CC2)c1.Cl |
| InChI | InChI=1S/C19H25N5OS.ClH/c1-13-3-4-15(26-2)11-16(13)19(25)23-8-5-14(6-9-23)18-22-21-17-12-20-7-10-24(17)18;/h3-4,11,14,20H,5-10,12H2,1-2H3;1H |
| InChIKey | BTHBYYLKXOUBGD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.97 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |