C19H25FN6O — CID 120823974
[4-(dimethylamino)-2-fluorophenyl]-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone (PubChem CID 120823974) has the molecular formula C19H25FN6O and a molecular weight of 372.45 g/mol. Its IUPAC name is [4-(dimethylamino)-2-fluorophenyl]-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone.
| Compound Name | [4-(dimethylamino)-2-fluorophenyl]-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 120823974 |
| Molecular Formula | C19H25FN6O |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | [4-(dimethylamino)-2-fluorophenyl]-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone |
| SMILES | CN(C)c1ccc(C(=O)N2CCC(c3nnc4n3CCNC4)CC2)c(F)c1 |
| InChI | InChI=1S/C19H25FN6O/c1-24(2)14-3-4-15(16(20)11-14)19(27)25-8-5-13(6-9-25)18-23-22-17-12-21-7-10-26(17)18/h3-4,11,13,21H,5-10,12H2,1-2H3 |
| InChIKey | UDVXPAWNSIASLD-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |