C17H20Cl3N5O — CID 120823234
(2,4-dichlorophenyl)-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone;hydrochloride (PubChem CID 120823234) has the molecular formula C17H20Cl3N5O and a molecular weight of 416.74 g/mol. Its IUPAC name is (2,4-dichlorophenyl)-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone;hydrochloride.
| Compound Name | (2,4-dichlorophenyl)-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 120823234 |
| Molecular Formula | C17H20Cl3N5O |
| Molecular Weight | 416.74 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | (2,4-dichlorophenyl)-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone;hydrochloride |
| SMILES | Cl.O=C(c1ccc(Cl)cc1Cl)N1CCC(c2nnc3n2CCNC3)CC1 |
| InChI | InChI=1S/C17H19Cl2N5O.ClH/c18-12-1-2-13(14(19)9-12)17(25)23-6-3-11(4-7-23)16-22-21-15-10-20-5-8-24(15)16;/h1-2,9,11,20H,3-8,10H2;1H |
| InChIKey | LQURCVPAKUFMKR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.74 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |