C18H21ClF3N5O — CID 120823741
[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]-[3-(trifluoromethyl)phenyl]methanone;hydrochloride (PubChem CID 120823741) has the molecular formula C18H21ClF3N5O and a molecular weight of 415.85 g/mol. Its IUPAC name is [4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]-[3-(trifluoromethyl)phenyl]methanone;hydrochloride.
| Compound Name | [4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]-[3-(trifluoromethyl)phenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 120823741 |
| Molecular Formula | C18H21ClF3N5O |
| Molecular Weight | 415.85 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | [4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]-[3-(trifluoromethyl)phenyl]methanone;hydrochloride |
| SMILES | Cl.O=C(c1cccc(C(F)(F)F)c1)N1CCC(c2nnc3n2CCNC3)CC1 |
| InChI | InChI=1S/C18H20F3N5O.ClH/c19-18(20,21)14-3-1-2-13(10-14)17(27)25-7-4-12(5-8-25)16-24-23-15-11-22-6-9-26(15)16;/h1-3,10,12,22H,4-9,11H2;1H |
| InChIKey | CCQFMHIADSOFSN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.85 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |