C18H21F2N5O — CID 120823862
[3-(difluoromethyl)phenyl]-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone (PubChem CID 120823862) has the molecular formula C18H21F2N5O and a molecular weight of 361.40 g/mol. Its IUPAC name is [3-(difluoromethyl)phenyl]-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone.
| Compound Name | [3-(difluoromethyl)phenyl]-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 120823862 |
| Molecular Formula | C18H21F2N5O |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | [3-(difluoromethyl)phenyl]-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1cccc(C(F)F)c1)N1CCC(c2nnc3n2CCNC3)CC1 |
| InChI | InChI=1S/C18H21F2N5O/c19-16(20)13-2-1-3-14(10-13)18(26)24-7-4-12(5-8-24)17-23-22-15-11-21-6-9-25(15)17/h1-3,10,12,16,21H,4-9,11H2 |
| InChIKey | LLLGUCHGXPVXMF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |