C22H28Cl2N6O — CID 120833567
(2,6-dimethylquinolin-3-yl)-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone;dihydrochloride (PubChem CID 120833567) has the molecular formula C22H28Cl2N6O and a molecular weight of 463.41 g/mol. Its IUPAC name is (2,6-dimethylquinolin-3-yl)-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone;dihydrochloride.
| Compound Name | (2,6-dimethylquinolin-3-yl)-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 120833567 |
| Molecular Formula | C22H28Cl2N6O |
| Molecular Weight | 463.41 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | (2,6-dimethylquinolin-3-yl)-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone;dihydrochloride |
| SMILES | Cc1ccc2nc(C)c(C(=O)N3CCC(c4nnc5n4CCNC5)CC3)cc2c1.Cl.Cl |
| InChI | InChI=1S/C22H26N6O.2ClH/c1-14-3-4-19-17(11-14)12-18(15(2)24-19)22(29)27-8-5-16(6-9-27)21-26-25-20-13-23-7-10-28(20)21;;/h3-4,11-12,16,23H,5-10,13H2,1-2H3;2*1H |
| InChIKey | LZNDUUYNHUCOFG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |