C16H21ClN6O3S — CID 120823174
(5-methyl-4-nitrothiophen-2-yl)-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone;hydrochloride (PubChem CID 120823174) has the molecular formula C16H21ClN6O3S and a molecular weight of 412.90 g/mol. Its IUPAC name is (5-methyl-4-nitrothiophen-2-yl)-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone;hydrochloride.
| Compound Name | (5-methyl-4-nitrothiophen-2-yl)-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 120823174 |
| Molecular Formula | C16H21ClN6O3S |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | (5-methyl-4-nitrothiophen-2-yl)-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone;hydrochloride |
| SMILES | Cc1sc(C(=O)N2CCC(c3nnc4n3CCNC4)CC2)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C16H20N6O3S.ClH/c1-10-12(22(24)25)8-13(26-10)16(23)20-5-2-11(3-6-20)15-19-18-14-9-17-4-7-21(14)15;/h8,11,17H,2-7,9H2,1H3;1H |
| InChIKey | APULRNOYNYRZHU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|