C19H25ClN6O3 — CID 120823799
2-(2-methyl-3-nitrophenyl)-1-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]ethanone;hydrochloride (PubChem CID 120823799) has the molecular formula C19H25ClN6O3 and a molecular weight of 420.90 g/mol. Its IUPAC name is 2-(2-methyl-3-nitrophenyl)-1-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]ethanone;hydrochloride.
| Compound Name | 2-(2-methyl-3-nitrophenyl)-1-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 120823799 |
| Molecular Formula | C19H25ClN6O3 |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 2-(2-methyl-3-nitrophenyl)-1-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]ethanone;hydrochloride |
| SMILES | Cc1c(CC(=O)N2CCC(c3nnc4n3CCNC4)CC2)cccc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C19H24N6O3.ClH/c1-13-15(3-2-4-16(13)25(27)28)11-18(26)23-8-5-14(6-9-23)19-22-21-17-12-20-7-10-24(17)19;/h2-4,14,20H,5-12H2,1H3;1H |
| InChIKey | ZEQCZKXTAUCVBM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|