C19H28ClN5 — CID 120826052
3-[1-[(2,3-dimethylphenyl)methyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;hydrochloride (PubChem CID 120826052) has the molecular formula C19H28ClN5 and a molecular weight of 361.92 g/mol. Its IUPAC name is 3-[1-[(2,3-dimethylphenyl)methyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;hydrochloride.
| Compound Name | 3-[1-[(2,3-dimethylphenyl)methyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;hydrochloride |
|---|---|
| PubChem CID | 120826052 |
| Molecular Formula | C19H28ClN5 |
| Molecular Weight | 361.92 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | 3-[1-[(2,3-dimethylphenyl)methyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;hydrochloride |
| SMILES | Cc1cccc(CN2CCC(c3nnc4n3CCNC4)CC2)c1C.Cl |
| InChI | InChI=1S/C19H27N5.ClH/c1-14-4-3-5-17(15(14)2)13-23-9-6-16(7-10-23)19-22-21-18-12-20-8-11-24(18)19;/h3-5,16,20H,6-13H2,1-2H3;1H |
| InChIKey | VTDUDHCGCJQOGG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.92 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |