C21H25N5S — CID 120826361
3-[1-[(5-phenylthiophen-2-yl)methyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 120826361) has the molecular formula C21H25N5S and a molecular weight of 379.53 g/mol. Its IUPAC name is 3-[1-[(5-phenylthiophen-2-yl)methyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 3-[1-[(5-phenylthiophen-2-yl)methyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 120826361 |
| Molecular Formula | C21H25N5S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 3-[1-[(5-phenylthiophen-2-yl)methyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | c1ccc(-c2ccc(CN3CCC(c4nnc5n4CCNC5)CC3)s2)cc1 |
| InChI | InChI=1S/C21H25N5S/c1-2-4-16(5-3-1)19-7-6-18(27-19)15-25-11-8-17(9-12-25)21-24-23-20-14-22-10-13-26(20)21/h1-7,17,22H,8-15H2 |
| InChIKey | SQNYKZJNZDEZNV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |