C16H21ClF3N5S — CID 120847238
3-[1-[[5-(trifluoromethyl)thiophen-2-yl]methyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;hydrochloride (PubChem CID 120847238) has the molecular formula C16H21ClF3N5S and a molecular weight of 407.89 g/mol. Its IUPAC name is 3-[1-[[5-(trifluoromethyl)thiophen-2-yl]methyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;hydrochloride.
| Compound Name | 3-[1-[[5-(trifluoromethyl)thiophen-2-yl]methyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;hydrochloride |
|---|---|
| PubChem CID | 120847238 |
| Molecular Formula | C16H21ClF3N5S |
| Molecular Weight | 407.89 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 3-[1-[[5-(trifluoromethyl)thiophen-2-yl]methyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;hydrochloride |
| SMILES | Cl.FC(F)(F)c1ccc(CN2CCC(c3nnc4n3CCNC4)CC2)s1 |
| InChI | InChI=1S/C16H20F3N5S.ClH/c17-16(18,19)13-2-1-12(25-13)10-23-6-3-11(4-7-23)15-22-21-14-9-20-5-8-24(14)15;/h1-2,11,20H,3-10H2;1H |
| InChIKey | RMUNHTGUHAYEDQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.89 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |