C18H22N6S2 — CID 120825893
5-[[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methyl]-2-thiophen-2-yl-1,3-thiazole (PubChem CID 120825893) has the molecular formula C18H22N6S2 and a molecular weight of 386.55 g/mol. Its IUPAC name is 5-[[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methyl]-2-thiophen-2-yl-1,3-thiazole.
| Compound Name | 5-[[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methyl]-2-thiophen-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 120825893 |
| Molecular Formula | C18H22N6S2 |
| Molecular Weight | 386.55 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 5-[[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methyl]-2-thiophen-2-yl-1,3-thiazole |
| SMILES | c1csc(-c2ncc(CN3CCC(c4nnc5n4CCNC5)CC3)s2)c1 |
| InChI | InChI=1S/C18H22N6S2/c1-2-15(25-9-1)18-20-10-14(26-18)12-23-6-3-13(4-7-23)17-22-21-16-11-19-5-8-24(16)17/h1-2,9-10,13,19H,3-8,11-12H2 |
| InChIKey | WRLWRYVDVHONKP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.55 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |