C19H29ClN6S — CID 120825896
2-cyclopentyl-5-[[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methyl]-1,3-thiazole;hydrochloride (PubChem CID 120825896) has the molecular formula C19H29ClN6S and a molecular weight of 409.00 g/mol. Its IUPAC name is 2-cyclopentyl-5-[[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methyl]-1,3-thiazole;hydrochloride.
| Compound Name | 2-cyclopentyl-5-[[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methyl]-1,3-thiazole;hydrochloride |
|---|---|
| PubChem CID | 120825896 |
| Molecular Formula | C19H29ClN6S |
| Molecular Weight | 409.00 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 2-cyclopentyl-5-[[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methyl]-1,3-thiazole;hydrochloride |
| SMILES | Cl.c1nc(C2CCCC2)sc1CN1CCC(c2nnc3n2CCNC3)CC1 |
| InChI | InChI=1S/C19H28N6S.ClH/c1-2-4-15(3-1)19-21-11-16(26-19)13-24-8-5-14(6-9-24)18-23-22-17-12-20-7-10-25(17)18;/h11,14-15,20H,1-10,12-13H2;1H |
| InChIKey | FDODPHVFFLCKRF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.00 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |