C15H20ClN5S — CID 120847215
3-[1-[(4-chlorothiophen-2-yl)methyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 120847215) has the molecular formula C15H20ClN5S and a molecular weight of 337.88 g/mol. Its IUPAC name is 3-[1-[(4-chlorothiophen-2-yl)methyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 3-[1-[(4-chlorothiophen-2-yl)methyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 120847215 |
| Molecular Formula | C15H20ClN5S |
| Molecular Weight | 337.88 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 3-[1-[(4-chlorothiophen-2-yl)methyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | Clc1csc(CN2CCC(c3nnc4n3CCNC4)CC2)c1 |
| InChI | InChI=1S/C15H20ClN5S/c16-12-7-13(22-10-12)9-20-4-1-11(2-5-20)15-19-18-14-8-17-3-6-21(14)15/h7,10-11,17H,1-6,8-9H2 |
| InChIKey | UISWQNQHPCDIKE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.88 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |