C18H22ClF2N5O — CID 120825879
3-[1-[[3-chloro-4-(difluoromethoxy)phenyl]methyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 120825879) has the molecular formula C18H22ClF2N5O and a molecular weight of 397.86 g/mol. Its IUPAC name is 3-[1-[[3-chloro-4-(difluoromethoxy)phenyl]methyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 3-[1-[[3-chloro-4-(difluoromethoxy)phenyl]methyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 120825879 |
| Molecular Formula | C18H22ClF2N5O |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 3-[1-[[3-chloro-4-(difluoromethoxy)phenyl]methyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | FC(F)Oc1ccc(CN2CCC(c3nnc4n3CCNC4)CC2)cc1Cl |
| InChI | InChI=1S/C18H22ClF2N5O/c19-14-9-12(1-2-15(14)27-18(20)21)11-25-6-3-13(4-7-25)17-24-23-16-10-22-5-8-26(16)17/h1-2,9,13,18,22H,3-8,10-11H2 |
| InChIKey | SJCSIDYNQUUEEY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |