C19H26ClN5 — CID 120826041
3-[1-[(4-chloro-2,6-dimethylphenyl)methyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 120826041) has the molecular formula C19H26ClN5 and a molecular weight of 359.91 g/mol. Its IUPAC name is 3-[1-[(4-chloro-2,6-dimethylphenyl)methyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 3-[1-[(4-chloro-2,6-dimethylphenyl)methyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 120826041 |
| Molecular Formula | C19H26ClN5 |
| Molecular Weight | 359.91 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 3-[1-[(4-chloro-2,6-dimethylphenyl)methyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | Cc1cc(Cl)cc(C)c1CN1CCC(c2nnc3n2CCNC3)CC1 |
| InChI | InChI=1S/C19H26ClN5/c1-13-9-16(20)10-14(2)17(13)12-24-6-3-15(4-7-24)19-23-22-18-11-21-5-8-25(18)19/h9-10,15,21H,3-8,11-12H2,1-2H3 |
| InChIKey | QTYVYCKZJQIWMA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.91 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |