C15H22N6S — CID 120825995
2-methyl-5-[[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methyl]-1,3-thiazole (PubChem CID 120825995) has the molecular formula C15H22N6S and a molecular weight of 318.45 g/mol. Its IUPAC name is 2-methyl-5-[[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methyl]-1,3-thiazole.
| Compound Name | 2-methyl-5-[[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 120825995 |
| Molecular Formula | C15H22N6S |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 2-methyl-5-[[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methyl]-1,3-thiazole |
| SMILES | Cc1ncc(CN2CCC(c3nnc4n3CCNC4)CC2)s1 |
| InChI | InChI=1S/C15H22N6S/c1-11-17-8-13(22-11)10-20-5-2-12(3-6-20)15-19-18-14-9-16-4-7-21(14)15/h8,12,16H,2-7,9-10H2,1H3 |
| InChIKey | IODJRLLYVSBDCU-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |