C20H29N5O2 — CID 120826025
3-[1-[(4,5-dimethoxy-2-methylphenyl)methyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 120826025) has the molecular formula C20H29N5O2 and a molecular weight of 371.49 g/mol. Its IUPAC name is 3-[1-[(4,5-dimethoxy-2-methylphenyl)methyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 3-[1-[(4,5-dimethoxy-2-methylphenyl)methyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 120826025 |
| Molecular Formula | C20H29N5O2 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | 3-[1-[(4,5-dimethoxy-2-methylphenyl)methyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | COc1cc(C)c(CN2CCC(c3nnc4n3CCNC4)CC2)cc1OC |
| InChI | InChI=1S/C20H29N5O2/c1-14-10-17(26-2)18(27-3)11-16(14)13-24-7-4-15(5-8-24)20-23-22-19-12-21-6-9-25(19)20/h10-11,15,21H,4-9,12-13H2,1-3H3 |
| InChIKey | VUIBAHXHCGJRMV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 64.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |