C19H28N6OS — CID 120823880
(2-tert-butyl-4-methyl-1,3-thiazol-5-yl)-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone (PubChem CID 120823880) has the molecular formula C19H28N6OS and a molecular weight of 388.54 g/mol. Its IUPAC name is (2-tert-butyl-4-methyl-1,3-thiazol-5-yl)-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone.
| Compound Name | (2-tert-butyl-4-methyl-1,3-thiazol-5-yl)-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 120823880 |
| Molecular Formula | C19H28N6OS |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | (2-tert-butyl-4-methyl-1,3-thiazol-5-yl)-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone |
| SMILES | Cc1nc(C(C)(C)C)sc1C(=O)N1CCC(c2nnc3n2CCNC3)CC1 |
| InChI | InChI=1S/C19H28N6OS/c1-12-15(27-18(21-12)19(2,3)4)17(26)24-8-5-13(6-9-24)16-23-22-14-11-20-7-10-25(14)16/h13,20H,5-11H2,1-4H3 |
| InChIKey | MZKQJPAZWLFXLT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |