C18H31N5O — CID 120822962
3,4,4-trimethyl-1-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]pentan-1-one (PubChem CID 120822962) has the molecular formula C18H31N5O and a molecular weight of 333.48 g/mol. Its IUPAC name is 3,4,4-trimethyl-1-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]pentan-1-one.
| Compound Name | 3,4,4-trimethyl-1-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 120822962 |
| Molecular Formula | C18H31N5O |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | 3,4,4-trimethyl-1-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]pentan-1-one |
| SMILES | CC(CC(=O)N1CCC(c2nnc3n2CCNC3)CC1)C(C)(C)C |
| InChI | InChI=1S/C18H31N5O/c1-13(18(2,3)4)11-16(24)22-8-5-14(6-9-22)17-21-20-15-12-19-7-10-23(15)17/h13-14,19H,5-12H2,1-4H3 |
| InChIKey | GLAGBUJIABTBQW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |