C18H30ClN5O — CID 120833225
(1-ethylcyclopentyl)-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone;hydrochloride (PubChem CID 120833225) has the molecular formula C18H30ClN5O and a molecular weight of 367.93 g/mol. Its IUPAC name is (1-ethylcyclopentyl)-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone;hydrochloride.
| Compound Name | (1-ethylcyclopentyl)-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 120833225 |
| Molecular Formula | C18H30ClN5O |
| Molecular Weight | 367.93 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | (1-ethylcyclopentyl)-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone;hydrochloride |
| SMILES | CCC1(C(=O)N2CCC(c3nnc4n3CCNC4)CC2)CCCC1.Cl |
| InChI | InChI=1S/C18H29N5O.ClH/c1-2-18(7-3-4-8-18)17(24)22-10-5-14(6-11-22)16-21-20-15-13-19-9-12-23(15)16;/h14,19H,2-13H2,1H3;1H |
| InChIKey | CXGAVQXHGWLTPO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.93 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |