C16H27N5O — CID 120823255
3,3-dimethyl-1-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]butan-1-one (PubChem CID 120823255) has the molecular formula C16H27N5O and a molecular weight of 305.43 g/mol. Its IUPAC name is 3,3-dimethyl-1-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]butan-1-one.
| Compound Name | 3,3-dimethyl-1-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 120823255 |
| Molecular Formula | C16H27N5O |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | 3,3-dimethyl-1-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]butan-1-one |
| SMILES | CC(C)(C)CC(=O)N1CCC(c2nnc3n2CCNC3)CC1 |
| InChI | InChI=1S/C16H27N5O/c1-16(2,3)10-14(22)20-7-4-12(5-8-20)15-19-18-13-11-17-6-9-21(13)15/h12,17H,4-11H2,1-3H3 |
| InChIKey | XJFMCFMANAZNRH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |