C18H29N5O — CID 120824006
[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone (PubChem CID 120824006) has the molecular formula C18H29N5O and a molecular weight of 331.46 g/mol. Its IUPAC name is [4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone.
| Compound Name | [4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone |
|---|---|
| PubChem CID | 120824006 |
| Molecular Formula | C18H29N5O |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.24 |
| IUPAC Name | [4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone |
| SMILES | CC1(C)C(C(=O)N2CCC(c3nnc4n3CCNC4)CC2)C1(C)C |
| InChI | InChI=1S/C18H29N5O/c1-17(2)14(18(17,3)4)16(24)22-8-5-12(6-9-22)15-21-20-13-11-19-7-10-23(13)15/h12,14,19H,5-11H2,1-4H3 |
| InChIKey | GULYMEXNBHLXFF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |