C21H28N6O2 — CID 120824090
3,5-dimethyl-N-[2-oxo-2-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]ethyl]benzamide (PubChem CID 120824090) has the molecular formula C21H28N6O2 and a molecular weight of 396.50 g/mol. Its IUPAC name is 3,5-dimethyl-N-[2-oxo-2-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]ethyl]benzamide.
| Compound Name | 3,5-dimethyl-N-[2-oxo-2-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 120824090 |
| Molecular Formula | C21H28N6O2 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 3,5-dimethyl-N-[2-oxo-2-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]ethyl]benzamide |
| SMILES | Cc1cc(C)cc(C(=O)NCC(=O)N2CCC(c3nnc4n3CCNC4)CC2)c1 |
| InChI | InChI=1S/C21H28N6O2/c1-14-9-15(2)11-17(10-14)21(29)23-13-19(28)26-6-3-16(4-7-26)20-25-24-18-12-22-5-8-27(18)20/h9-11,16,22H,3-8,12-13H2,1-2H3,(H,23,29) |
| InChIKey | NKANJTSEPSWBMB-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |