C21H29N5OS — CID 120822988
2-(4-propan-2-ylphenyl)sulfanyl-1-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]ethanone (PubChem CID 120822988) has the molecular formula C21H29N5OS and a molecular weight of 399.56 g/mol. Its IUPAC name is 2-(4-propan-2-ylphenyl)sulfanyl-1-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]ethanone.
| Compound Name | 2-(4-propan-2-ylphenyl)sulfanyl-1-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 120822988 |
| Molecular Formula | C21H29N5OS |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 2-(4-propan-2-ylphenyl)sulfanyl-1-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]ethanone |
| SMILES | CC(C)c1ccc(SCC(=O)N2CCC(c3nnc4n3CCNC4)CC2)cc1 |
| InChI | InChI=1S/C21H29N5OS/c1-15(2)16-3-5-18(6-4-16)28-14-20(27)25-10-7-17(8-11-25)21-24-23-19-13-22-9-12-26(19)21/h3-6,15,17,22H,7-14H2,1-2H3 |
| InChIKey | UGMZYLRQADGMAH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |