C23H24N2O2S — CID 157416789
1-(2,4-diphenyl-1,3-thiazol-5-yl)-4-morpholin-4-ylbutan-1-one (PubChem CID 157416789) has the molecular formula C23H24N2O2S and a molecular weight of 392.52 g/mol. Its IUPAC name is 1-(2,4-diphenyl-1,3-thiazol-5-yl)-4-morpholin-4-ylbutan-1-one.
| Compound Name | 1-(2,4-diphenyl-1,3-thiazol-5-yl)-4-morpholin-4-ylbutan-1-one |
|---|---|
| PubChem CID | 157416789 |
| Molecular Formula | C23H24N2O2S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 1-(2,4-diphenyl-1,3-thiazol-5-yl)-4-morpholin-4-ylbutan-1-one |
| SMILES | O=C(CCCN1CCOCC1)c1sc(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C23H24N2O2S/c26-20(12-7-13-25-14-16-27-17-15-25)22-21(18-8-3-1-4-9-18)24-23(28-22)19-10-5-2-6-11-19/h1-6,8-11H,7,12-17H2 |
| InChIKey | DZIMISWLHVAZSN-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |