C26H36N4O3S — CID 53103665
2-[1-(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)piperidin-4-yl]-N-(3-morpholin-4-ylpropyl)propanamide (PubChem CID 53103665) has the molecular formula C26H36N4O3S and a molecular weight of 484.67 g/mol. Its IUPAC name is 2-[1-(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)piperidin-4-yl]-N-(3-morpholin-4-ylpropyl)propanamide.
| Compound Name | 2-[1-(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)piperidin-4-yl]-N-(3-morpholin-4-ylpropyl)propanamide |
|---|---|
| PubChem CID | 53103665 |
| Molecular Formula | C26H36N4O3S |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | 2-[1-(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)piperidin-4-yl]-N-(3-morpholin-4-ylpropyl)propanamide |
| SMILES | Cc1nc(-c2ccccc2)sc1C(=O)N1CCC(C(C)C(=O)NCCCN2CCOCC2)CC1 |
| InChI | InChI=1S/C26H36N4O3S/c1-19(24(31)27-11-6-12-29-15-17-33-18-16-29)21-9-13-30(14-10-21)26(32)23-20(2)28-25(34-23)22-7-4-3-5-8-22/h3-5,7-8,19,21H,6,9-18H2,1-2H3,(H,27,31) |
| InChIKey | IEJBNBRNQXKZSU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|