C26H35FN4O2S — CID 95084446
(2R)-2-[1-[2-(4-fluorophenyl)-4-methyl-1,3-thiazole-5-carbonyl]piperidin-4-yl]-N-(3-pyrrolidin-1-ylpropyl)propanamide (PubChem CID 95084446) has the molecular formula C26H35FN4O2S and a molecular weight of 486.66 g/mol. Its IUPAC name is (2R)-2-[1-[2-(4-fluorophenyl)-4-methyl-1,3-thiazole-5-carbonyl]piperidin-4-yl]-N-(3-pyrrolidin-1-ylpropyl)propanamide.
| Compound Name | (2R)-2-[1-[2-(4-fluorophenyl)-4-methyl-1,3-thiazole-5-carbonyl]piperidin-4-yl]-N-(3-pyrrolidin-1-ylpropyl)propanamide |
|---|---|
| PubChem CID | 95084446 |
| Molecular Formula | C26H35FN4O2S |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | (2R)-2-[1-[2-(4-fluorophenyl)-4-methyl-1,3-thiazole-5-carbonyl]piperidin-4-yl]-N-(3-pyrrolidin-1-ylpropyl)propanamide |
| SMILES | Cc1nc(-c2ccc(F)cc2)sc1C(=O)N1CCC([C@@H](C)C(=O)NCCCN2CCCC2)CC1 |
| InChI | InChI=1S/C26H35FN4O2S/c1-18(24(32)28-12-5-15-30-13-3-4-14-30)20-10-16-31(17-11-20)26(33)23-19(2)29-25(34-23)21-6-8-22(27)9-7-21/h6-9,18,20H,3-5,10-17H2,1-2H3,(H,28,32)/t18-/m1/s1 |
| InChIKey | DGPZVOSZOAZWJE-GOSISDBHSA-N |
| XLogP | 4.35 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|