C16H11NO3S — CID 136889078
2-(4-hydroxyphenyl)-4-phenyl-1,3-thiazole-5-carboxylic acid (PubChem CID 136889078) has the molecular formula C16H11NO3S and a molecular weight of 297.34 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)-4-phenyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(4-hydroxyphenyl)-4-phenyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 136889078 |
| Molecular Formula | C16H11NO3S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 2-(4-hydroxyphenyl)-4-phenyl-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1sc(-c2ccc(O)cc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C16H11NO3S/c18-12-8-6-11(7-9-12)15-17-13(14(21-15)16(19)20)10-4-2-1-3-5-10/h1-9,18H,(H,19,20) |
| InChIKey | UCFQJSAXBVJILD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |