C15H11N3O2S — CID 82227073
4-(4-aminophenyl)-2-pyridin-2-yl-1,3-thiazole-5-carboxylic acid (PubChem CID 82227073) has the molecular formula C15H11N3O2S and a molecular weight of 297.34 g/mol. Its IUPAC name is 4-(4-aminophenyl)-2-pyridin-2-yl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 4-(4-aminophenyl)-2-pyridin-2-yl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 82227073 |
| Molecular Formula | C15H11N3O2S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 4-(4-aminophenyl)-2-pyridin-2-yl-1,3-thiazole-5-carboxylic acid |
| SMILES | Nc1ccc(-c2nc(-c3ccccn3)sc2C(=O)O)cc1 |
| InChI | InChI=1S/C15H11N3O2S/c16-10-6-4-9(5-7-10)12-13(15(19)20)21-14(18-12)11-3-1-2-8-17-11/h1-8H,16H2,(H,19,20) |
| InChIKey | UMSJUYQIGHXVHT-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|