C21H15N3OS — CID 17473227
N,4-diphenyl-2-pyridin-2-yl-1,3-thiazole-5-carboxamide (PubChem CID 17473227) has the molecular formula C21H15N3OS and a molecular weight of 357.44 g/mol. Its IUPAC name is N,4-diphenyl-2-pyridin-2-yl-1,3-thiazole-5-carboxamide.
| Compound Name | N,4-diphenyl-2-pyridin-2-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 17473227 |
| Molecular Formula | C21H15N3OS |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | N,4-diphenyl-2-pyridin-2-yl-1,3-thiazole-5-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1sc(-c2ccccn2)nc1-c1ccccc1 |
| InChI | InChI=1S/C21H15N3OS/c25-20(23-16-11-5-2-6-12-16)19-18(15-9-3-1-4-10-15)24-21(26-19)17-13-7-8-14-22-17/h1-14H,(H,23,25) |
| InChIKey | DCCMXMWNMOORBR-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |