C24H19N3O2S — CID 9074270
N-(3-acetamidophenyl)-2,4-diphenyl-1,3-thiazole-5-carboxamide (PubChem CID 9074270) has the molecular formula C24H19N3O2S and a molecular weight of 413.50 g/mol. Its IUPAC name is N-(3-acetamidophenyl)-2,4-diphenyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-(3-acetamidophenyl)-2,4-diphenyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 9074270 |
| Molecular Formula | C24H19N3O2S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | N-(3-acetamidophenyl)-2,4-diphenyl-1,3-thiazole-5-carboxamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)c2sc(-c3ccccc3)nc2-c2ccccc2)c1 |
| InChI | InChI=1S/C24H19N3O2S/c1-16(28)25-19-13-8-14-20(15-19)26-23(29)22-21(17-9-4-2-5-10-17)27-24(30-22)18-11-6-3-7-12-18/h2-15H,1H3,(H,25,28)(H,26,29) |
| InChIKey | YOCNLEMZIRYRSD-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |