C18H13N5OS — CID 30864538
2,4-diphenyl-N-(1H-1,2,4-triazol-5-yl)-1,3-thiazole-5-carboxamide (PubChem CID 30864538) has the molecular formula C18H13N5OS and a molecular weight of 347.40 g/mol. Its IUPAC name is 2,4-diphenyl-N-(1H-1,2,4-triazol-5-yl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2,4-diphenyl-N-(1H-1,2,4-triazol-5-yl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 30864538 |
| Molecular Formula | C18H13N5OS |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 2,4-diphenyl-N-(1H-1,2,4-triazol-5-yl)-1,3-thiazole-5-carboxamide |
| SMILES | O=C(Nc1ncn[nH]1)c1sc(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C18H13N5OS/c24-16(22-18-19-11-20-23-18)15-14(12-7-3-1-4-8-12)21-17(25-15)13-9-5-2-6-10-13/h1-11H,(H2,19,20,22,23,24) |
| InChIKey | ANWPUKSOOHRLOC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |