C22H23N3OS — CID 119477493
N-(4-aminocyclohexyl)-2,4-diphenyl-1,3-thiazole-5-carboxamide (PubChem CID 119477493) has the molecular formula C22H23N3OS and a molecular weight of 377.51 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-2,4-diphenyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-(4-aminocyclohexyl)-2,4-diphenyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 119477493 |
| Molecular Formula | C22H23N3OS |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | N-(4-aminocyclohexyl)-2,4-diphenyl-1,3-thiazole-5-carboxamide |
| SMILES | NC1CCC(NC(=O)c2sc(-c3ccccc3)nc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C22H23N3OS/c23-17-11-13-18(14-12-17)24-21(26)20-19(15-7-3-1-4-8-15)25-22(27-20)16-9-5-2-6-10-16/h1-10,17-18H,11-14,23H2,(H,24,26) |
| InChIKey | HHPAKCIDZYBANZ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |