C22H23N3OS — CID 120557670
N-(3-methylpiperidin-4-yl)-2,4-diphenyl-1,3-thiazole-5-carboxamide (PubChem CID 120557670) has the molecular formula C22H23N3OS and a molecular weight of 377.51 g/mol. Its IUPAC name is N-(3-methylpiperidin-4-yl)-2,4-diphenyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-(3-methylpiperidin-4-yl)-2,4-diphenyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 120557670 |
| Molecular Formula | C22H23N3OS |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | N-(3-methylpiperidin-4-yl)-2,4-diphenyl-1,3-thiazole-5-carboxamide |
| SMILES | CC1CNCCC1NC(=O)c1sc(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C22H23N3OS/c1-15-14-23-13-12-18(15)24-21(26)20-19(16-8-4-2-5-9-16)25-22(27-20)17-10-6-3-7-11-17/h2-11,15,18,23H,12-14H2,1H3,(H,24,26) |
| InChIKey | XIRNUIDQARTCCM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |