C22H21N3O2S — CID 94130735
N-[(3R)-2-oxoazepan-3-yl]-2,4-diphenyl-1,3-thiazole-5-carboxamide (PubChem CID 94130735) has the molecular formula C22H21N3O2S and a molecular weight of 391.50 g/mol. Its IUPAC name is N-[(3R)-2-oxoazepan-3-yl]-2,4-diphenyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(3R)-2-oxoazepan-3-yl]-2,4-diphenyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 94130735 |
| Molecular Formula | C22H21N3O2S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | N-[(3R)-2-oxoazepan-3-yl]-2,4-diphenyl-1,3-thiazole-5-carboxamide |
| SMILES | O=C(N[C@@H]1CCCCNC1=O)c1sc(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C22H21N3O2S/c26-20-17(13-7-8-14-23-20)24-21(27)19-18(15-9-3-1-4-10-15)25-22(28-19)16-11-5-2-6-12-16/h1-6,9-12,17H,7-8,13-14H2,(H,23,26)(H,24,27)/t17-/m1/s1 |
| InChIKey | AIIUJKVRKSGSTE-QGZVFWFLSA-N |
| XLogP | 3.88 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |