C15H17N3O2S — CID 51089154
N-(2-oxoazepan-3-yl)-3-pyrrol-1-ylthiophene-2-carboxamide (PubChem CID 51089154) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is N-(2-oxoazepan-3-yl)-3-pyrrol-1-ylthiophene-2-carboxamide.
| Compound Name | N-(2-oxoazepan-3-yl)-3-pyrrol-1-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 51089154 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | N-(2-oxoazepan-3-yl)-3-pyrrol-1-ylthiophene-2-carboxamide |
| SMILES | O=C(NC1CCCCNC1=O)c1sccc1-n1cccc1 |
| InChI | InChI=1S/C15H17N3O2S/c19-14-11(5-1-2-7-16-14)17-15(20)13-12(6-10-21-13)18-8-3-4-9-18/h3-4,6,8-11H,1-2,5,7H2,(H,16,19)(H,17,20) |
| InChIKey | MOBPMHNNZZXSBG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |