C15H17N3O2S — CID 71935632
N-(2-oxopiperidin-3-yl)-1-(thiophen-2-ylmethyl)pyrrole-2-carboxamide (PubChem CID 71935632) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is N-(2-oxopiperidin-3-yl)-1-(thiophen-2-ylmethyl)pyrrole-2-carboxamide.
| Compound Name | N-(2-oxopiperidin-3-yl)-1-(thiophen-2-ylmethyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 71935632 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | N-(2-oxopiperidin-3-yl)-1-(thiophen-2-ylmethyl)pyrrole-2-carboxamide |
| SMILES | O=C(NC1CCCNC1=O)c1cccn1Cc1cccs1 |
| InChI | InChI=1S/C15H17N3O2S/c19-14-12(5-1-7-16-14)17-15(20)13-6-2-8-18(13)10-11-4-3-9-21-11/h2-4,6,8-9,12H,1,5,7,10H2,(H,16,19)(H,17,20) |
| InChIKey | DIBNLEXYUNLHMO-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |