C22H24N4OS — CID 39115704
2-amino-N-(1-benzylpiperidin-4-yl)-4-phenyl-1,3-thiazole-5-carboxamide (PubChem CID 39115704) has the molecular formula C22H24N4OS and a molecular weight of 392.53 g/mol. Its IUPAC name is 2-amino-N-(1-benzylpiperidin-4-yl)-4-phenyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-amino-N-(1-benzylpiperidin-4-yl)-4-phenyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 39115704 |
| Molecular Formula | C22H24N4OS |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 2-amino-N-(1-benzylpiperidin-4-yl)-4-phenyl-1,3-thiazole-5-carboxamide |
| SMILES | Nc1nc(-c2ccccc2)c(C(=O)NC2CCN(Cc3ccccc3)CC2)s1 |
| InChI | InChI=1S/C22H24N4OS/c23-22-25-19(17-9-5-2-6-10-17)20(28-22)21(27)24-18-11-13-26(14-12-18)15-16-7-3-1-4-8-16/h1-10,18H,11-15H2,(H2,23,25)(H,24,27) |
| InChIKey | AKCZKHBCOMUGJY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |