C24H27N3OS — CID 39084162
2-benzyl-N-(1-benzylpiperidin-4-yl)-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 39084162) has the molecular formula C24H27N3OS and a molecular weight of 405.57 g/mol. Its IUPAC name is 2-benzyl-N-(1-benzylpiperidin-4-yl)-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-benzyl-N-(1-benzylpiperidin-4-yl)-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 39084162 |
| Molecular Formula | C24H27N3OS |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 2-benzyl-N-(1-benzylpiperidin-4-yl)-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(Cc2ccccc2)sc1C(=O)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H27N3OS/c1-18-23(29-22(25-18)16-19-8-4-2-5-9-19)24(28)26-21-12-14-27(15-13-21)17-20-10-6-3-7-11-20/h2-11,21H,12-17H2,1H3,(H,26,28) |
| InChIKey | RLAAJOYFWTWGFF-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |