C15H11ClN4O — CID 71931815
2-chloro-5-phenyl-N-(1H-1,2,4-triazol-5-yl)benzamide (PubChem CID 71931815) has the molecular formula C15H11ClN4O and a molecular weight of 298.73 g/mol. Its IUPAC name is 2-chloro-5-phenyl-N-(1H-1,2,4-triazol-5-yl)benzamide.
| Compound Name | 2-chloro-5-phenyl-N-(1H-1,2,4-triazol-5-yl)benzamide |
|---|---|
| PubChem CID | 71931815 |
| Molecular Formula | C15H11ClN4O |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2-chloro-5-phenyl-N-(1H-1,2,4-triazol-5-yl)benzamide |
| SMILES | O=C(Nc1ncn[nH]1)c1cc(-c2ccccc2)ccc1Cl |
| InChI | InChI=1S/C15H11ClN4O/c16-13-7-6-11(10-4-2-1-3-5-10)8-12(13)14(21)19-15-17-9-18-20-15/h1-9H,(H2,17,18,19,20,21) |
| InChIKey | MRLJLZOLEKKGED-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |