C8H5Cl2N5O — CID 104986154
2,5-dichloro-N-(1H-1,2,4-triazol-5-yl)pyridine-4-carboxamide (PubChem CID 104986154) has the molecular formula C8H5Cl2N5O and a molecular weight of 258.07 g/mol. Its IUPAC name is 2,5-dichloro-N-(1H-1,2,4-triazol-5-yl)pyridine-4-carboxamide.
| Compound Name | 2,5-dichloro-N-(1H-1,2,4-triazol-5-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 104986154 |
| Molecular Formula | C8H5Cl2N5O |
| Molecular Weight | 258.07 g/mol |
| Exact Mass | 256.99 |
| IUPAC Name | 2,5-dichloro-N-(1H-1,2,4-triazol-5-yl)pyridine-4-carboxamide |
| SMILES | O=C(Nc1ncn[nH]1)c1cc(Cl)ncc1Cl |
| InChI | InChI=1S/C8H5Cl2N5O/c9-5-2-11-6(10)1-4(5)7(16)14-8-12-3-13-15-8/h1-3H,(H2,12,13,14,15,16) |
| InChIKey | QWCIZGYIIDYQBV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.07 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|