C9H7FN4O2 — CID 103829726
4-fluoro-2-hydroxy-N-(1H-1,2,4-triazol-5-yl)benzamide (PubChem CID 103829726) has the molecular formula C9H7FN4O2 and a molecular weight of 222.18 g/mol. Its IUPAC name is 4-fluoro-2-hydroxy-N-(1H-1,2,4-triazol-5-yl)benzamide.
| Compound Name | 4-fluoro-2-hydroxy-N-(1H-1,2,4-triazol-5-yl)benzamide |
|---|---|
| PubChem CID | 103829726 |
| Molecular Formula | C9H7FN4O2 |
| Molecular Weight | 222.18 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 4-fluoro-2-hydroxy-N-(1H-1,2,4-triazol-5-yl)benzamide |
| SMILES | O=C(Nc1ncn[nH]1)c1ccc(F)cc1O |
| InChI | InChI=1S/C9H7FN4O2/c10-5-1-2-6(7(15)3-5)8(16)13-9-11-4-12-14-9/h1-4,15H,(H2,11,12,13,14,16) |
| InChIKey | PSDJHWHHPBPNRY-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.18 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |