C10H8FN3O2 — CID 103829854
4-fluoro-2-hydroxy-N-(1H-pyrazol-5-yl)benzamide (PubChem CID 103829854) has the molecular formula C10H8FN3O2 and a molecular weight of 221.19 g/mol. Its IUPAC name is 4-fluoro-2-hydroxy-N-(1H-pyrazol-5-yl)benzamide.
| Compound Name | 4-fluoro-2-hydroxy-N-(1H-pyrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 103829854 |
| Molecular Formula | C10H8FN3O2 |
| Molecular Weight | 221.19 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 4-fluoro-2-hydroxy-N-(1H-pyrazol-5-yl)benzamide |
| SMILES | O=C(Nc1ccn[nH]1)c1ccc(F)cc1O |
| InChI | InChI=1S/C10H8FN3O2/c11-6-1-2-7(8(15)5-6)10(16)13-9-3-4-12-14-9/h1-5,15H,(H2,12,13,14,16) |
| InChIKey | JPGBATBMDNAFGL-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.19 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |