C10H7F2N3O2 — CID 47466440
2,4-difluoro-6-hydroxy-N-(1H-pyrazol-5-yl)benzamide (PubChem CID 47466440) has the molecular formula C10H7F2N3O2 and a molecular weight of 239.18 g/mol. Its IUPAC name is 2,4-difluoro-6-hydroxy-N-(1H-pyrazol-5-yl)benzamide.
| Compound Name | 2,4-difluoro-6-hydroxy-N-(1H-pyrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 47466440 |
| Molecular Formula | C10H7F2N3O2 |
| Molecular Weight | 239.18 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 2,4-difluoro-6-hydroxy-N-(1H-pyrazol-5-yl)benzamide |
| SMILES | O=C(Nc1ccn[nH]1)c1c(O)cc(F)cc1F |
| InChI | InChI=1S/C10H7F2N3O2/c11-5-3-6(12)9(7(16)4-5)10(17)14-8-1-2-13-15-8/h1-4,16H,(H2,13,14,15,17) |
| InChIKey | OTCNWEGTLKMMAJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.18 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |