C16H13F2NO2 — CID 60598957
N-(2,3-dihydro-1H-inden-5-yl)-2,4-difluoro-6-hydroxybenzamide (PubChem CID 60598957) has the molecular formula C16H13F2NO2 and a molecular weight of 289.28 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-5-yl)-2,4-difluoro-6-hydroxybenzamide.
| Compound Name | N-(2,3-dihydro-1H-inden-5-yl)-2,4-difluoro-6-hydroxybenzamide |
|---|---|
| PubChem CID | 60598957 |
| Molecular Formula | C16H13F2NO2 |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-5-yl)-2,4-difluoro-6-hydroxybenzamide |
| SMILES | O=C(Nc1ccc2c(c1)CCC2)c1c(O)cc(F)cc1F |
| InChI | InChI=1S/C16H13F2NO2/c17-11-7-13(18)15(14(20)8-11)16(21)19-12-5-4-9-2-1-3-10(9)6-12/h4-8,20H,1-3H2,(H,19,21) |
| InChIKey | QTBZXYZEDWCCRG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |