C15H14F2N2O4S — CID 86861751
N-[4-(ethylsulfonylamino)phenyl]-2,4-difluoro-6-hydroxybenzamide (PubChem CID 86861751) has the molecular formula C15H14F2N2O4S and a molecular weight of 356.35 g/mol. Its IUPAC name is N-[4-(ethylsulfonylamino)phenyl]-2,4-difluoro-6-hydroxybenzamide.
| Compound Name | N-[4-(ethylsulfonylamino)phenyl]-2,4-difluoro-6-hydroxybenzamide |
|---|---|
| PubChem CID | 86861751 |
| Molecular Formula | C15H14F2N2O4S |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | N-[4-(ethylsulfonylamino)phenyl]-2,4-difluoro-6-hydroxybenzamide |
| SMILES | CCS(=O)(=O)Nc1ccc(NC(=O)c2c(O)cc(F)cc2F)cc1 |
| InChI | InChI=1S/C15H14F2N2O4S/c1-2-24(22,23)19-11-5-3-10(4-6-11)18-15(21)14-12(17)7-9(16)8-13(14)20/h3-8,19-20H,2H2,1H3,(H,18,21) |
| InChIKey | QFPGLRXUCOJPRK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |